C14H9N5O5 — CID 58533287
3,4-bis(4-nitrophenyl)-1H-1,2,4-triazol-5-one (PubChem CID 58533287) has the molecular formula C14H9N5O5 and a molecular weight of 327.26 g/mol. Its IUPAC name is 3,4-bis(4-nitrophenyl)-1H-1,2,4-triazol-5-one.
| Compound Name | 3,4-bis(4-nitrophenyl)-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 58533287 |
| Molecular Formula | C14H9N5O5 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 3,4-bis(4-nitrophenyl)-1H-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]nc(-c2ccc([N+](=O)[O-])cc2)n1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H9N5O5/c20-14-16-15-13(9-1-3-11(4-2-9)18(21)22)17(14)10-5-7-12(8-6-10)19(23)24/h1-8H,(H,16,20) |
| InChIKey | SAAWYZHFYKYNMC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 136.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|