C23H29F3N2O6S — CID 58533383
[3-[[(2S)-1-[(2S)-3-methyl-2-(2-methylpropanoylamino)butanoyl]pyrrolidin-2-yl]methyl]-1-benzofuran-5-yl] trifluoromethanesulfonate (PubChem CID 58533383) has the molecular formula C23H29F3N2O6S and a molecular weight of 518.55 g/mol. Its IUPAC name is [3-[[(2S)-1-[(2S)-3-methyl-2-(2-methylpropanoylamino)butanoyl]pyrrolidin-2-yl]methyl]-1-benzofuran-5-yl] trifluoromethanesulfonate.
| Compound Name | [3-[[(2S)-1-[(2S)-3-methyl-2-(2-methylpropanoylamino)butanoyl]pyrrolidin-2-yl]methyl]-1-benzofuran-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58533383 |
| Molecular Formula | C23H29F3N2O6S |
| Molecular Weight | 518.55 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | [3-[[(2S)-1-[(2S)-3-methyl-2-(2-methylpropanoylamino)butanoyl]pyrrolidin-2-yl]methyl]-1-benzofuran-5-yl] trifluoromethanesulfonate |
| SMILES | CC(C)C(=O)N[C@H](C(=O)N1CCC[C@H]1Cc1coc2ccc(OS(=O)(=O)C(F)(F)F)cc12)C(C)C |
| InChI | InChI=1S/C23H29F3N2O6S/c1-13(2)20(27-21(29)14(3)4)22(30)28-9-5-6-16(28)10-15-12-33-19-8-7-17(11-18(15)19)34-35(31,32)23(24,25)26/h7-8,11-14,16,20H,5-6,9-10H2,1-4H3,(H,27,29)/t16-,20-/m0/s1 |
| InChIKey | DOLUKVGGKPMGEZ-JXFKEZNVSA-N |
| XLogP | 3.99 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|