About 5,6-dihydro-4H-cyclopenta[b]pyridin-4-id-7-one;tungsten
5,6-dihydro-4H-cyclopenta[b]pyridin-4-id-7-one;tungsten (PubChem CID 58533636) has the molecular formula C8H6NOW-
and a molecular weight of 315.98 g/mol. Its IUPAC name is 5,6-dihydro-4H-cyclopenta[b]pyridin-4-id-7-one;tungsten.
Molecular Properties
| Compound Name | 5,6-dihydro-4H-cyclopenta[b]pyridin-4-id-7-one;tungsten |
| PubChem CID | 58533636 |
| Molecular Formula | C8H6NOW- |
| Molecular Weight | 315.98 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 5,6-dihydro-4H-cyclopenta[b]pyridin-4-id-7-one;tungsten |
| SMILES | O=C1CCc2[c-]ccnc21.[W] |
| InChI | InChI=1S/C8H6NO.W/c10-7-4-3-6-2-1-5-9-8(6)7;/h1,5H,3-4H2;/q-1; |
| InChIKey | DYXBSZYCIUSHDG-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.98 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dihydro-4H-cyclopenta[b]pyridin-4-id-7-one;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydro-4H-cyclopenta[b]pyridin-4-id-7-one;tungsten?
The IUPAC name of 5,6-dihydro-4H-cyclopenta[b]pyridin-4-id-7-one;tungsten (CID 58533636) is 5,6-dihydro-4H-cyclopenta[b]pyridin-4-id-7-one;tungsten.
What is the SMILES notation for 5,6-dihydro-4H-cyclopenta[b]pyridin-4-id-7-one;tungsten?
The canonical SMILES for 5,6-dihydro-4H-cyclopenta[b]pyridin-4-id-7-one;tungsten is O=C1CCc2[c-]ccnc21.[W].
What is the InChIKey of 5,6-dihydro-4H-cyclopenta[b]pyridin-4-id-7-one;tungsten?
The InChIKey is DYXBSZYCIUSHDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6NO.W/c10-7-4-3-6-2-1-5-9-8(6)7;/h1,5H,3-4H2;/q-1;.
What are the key properties of 5,6-dihydro-4H-cyclopenta[b]pyridin-4-id-7-one;tungsten?
5,6-dihydro-4H-cyclopenta[b]pyridin-4-id-7-one;tungsten has a molecular weight of 315.98 g/mol, XLogP of 1.01, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-4H-cyclopenta[b]pyridin-4-id-7-one;tungsten is sourced from PubChem (CID 58533636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).