About CID 58533917
CID 58533917 (PubChem CID 58533917) has the molecular formula C24H34BNO12PW-
and a molecular weight of 754.16 g/mol.
Molecular Properties
| Compound Name | CID 58533917 |
| PubChem CID | 58533917 |
| Molecular Formula | C24H34BNO12PW- |
| Molecular Weight | 754.16 g/mol |
| Exact Mass | 754.14 |
| IUPAC Name | — |
| SMILES | [B][C@H]1[CH-]C(OC)[C@@H](COP(OC)OC2C(OC(=O)COc3ccc(OCC(=O)NC)cc3)[C@H](C)O[C@@H]2OC)O1.[W] |
| InChI | InChI=1S/C24H34BNO12P.W/c1-14-22(37-21(28)13-33-16-8-6-15(7-9-16)32-12-20(27)26-2)23(24(30-4)35-14)38-39(31-5)34-11-18-17(29-3)10-19(25)36-18;/h6-10,14,17-19,22-24H,11-13H2,1-5H3,(H,26,27);/q-1;/t14-,17?,18+,19+,22?,23?,24-,39?;/m0./s1 |
| InChIKey | QYBSMLKXBDWHMZ-FJCDTTJGSA-N |
| XLogP | 0.88 |
| TPSA | 138.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 754.16 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 58533917 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58533917?
The IUPAC name of CID 58533917 (CID 58533917) is not available.
What is the SMILES notation for CID 58533917?
The canonical SMILES for CID 58533917 is [B][C@H]1[CH-]C(OC)[C@@H](COP(OC)OC2C(OC(=O)COc3ccc(OCC(=O)NC)cc3)[C@H](C)O[C@@H]2OC)O1.[W].
What is the InChIKey of CID 58533917?
The InChIKey is QYBSMLKXBDWHMZ-FJCDTTJGSA-N. The full InChI is InChI=1S/C24H34BNO12P.W/c1-14-22(37-21(28)13-33-16-8-6-15(7-9-16)32-12-20(27)26-2)23(24(30-4)35-14)38-39(31-5)34-11-18-17(29-3)10-19(25)36-18;/h6-10,14,17-19,22-24H,11-13H2,1-5H3,(H,26,27);/q-1;/t14-,17?,18+,19+,22?,23?,24-,39?;/m0./s1.
What are the key properties of CID 58533917?
CID 58533917 has a molecular weight of 754.16 g/mol, XLogP of 0.88, 15 rotatable bonds, 1 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58533917 is sourced from PubChem (CID 58533917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).