About CID 58533958
CID 58533958 (PubChem CID 58533958) has the molecular formula C23H32B2NO10P
and a molecular weight of 535.10 g/mol.
Molecular Properties
| Compound Name | CID 58533958 |
| PubChem CID | 58533958 |
| Molecular Formula | C23H32B2NO10P |
| Molecular Weight | 535.10 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | — |
| SMILES | [B][C@H]1CC(OC(=O)COc2ccc(OCC(=O)NC)cc2)[C@@H](COP(OC)OC2C[C@H]([B])O[C@@H]2CC)O1 |
| InChI | InChI=1S/C23H32B2NO10P/c1-4-16-18(10-21(25)33-16)36-37(29-3)32-11-19-17(9-20(24)34-19)35-23(28)13-31-15-7-5-14(6-8-15)30-12-22(27)26-2/h5-8,16-21H,4,9-13H2,1-3H3,(H,26,27)/t16-,17?,18?,19-,20-,21-,37?/m1/s1 |
| InChIKey | OPRPSEQGLCFNHS-XAWYYROCSA-N |
| XLogP | 1.35 |
| TPSA | 120.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 535.10 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 58533958 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58533958?
The IUPAC name of CID 58533958 (CID 58533958) is not available.
What is the SMILES notation for CID 58533958?
The canonical SMILES for CID 58533958 is [B][C@H]1CC(OC(=O)COc2ccc(OCC(=O)NC)cc2)[C@@H](COP(OC)OC2C[C@H]([B])O[C@@H]2CC)O1.
What is the InChIKey of CID 58533958?
The InChIKey is OPRPSEQGLCFNHS-XAWYYROCSA-N. The full InChI is InChI=1S/C23H32B2NO10P/c1-4-16-18(10-21(25)33-16)36-37(29-3)32-11-19-17(9-20(24)34-19)35-23(28)13-31-15-7-5-14(6-8-15)30-12-22(27)26-2/h5-8,16-21H,4,9-13H2,1-3H3,(H,26,27)/t16-,17?,18?,19-,20-,21-,37?/m1/s1.
What are the key properties of CID 58533958?
CID 58533958 has a molecular weight of 535.10 g/mol, XLogP of 1.35, 14 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58533958 is sourced from PubChem (CID 58533958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).