About 2-(1-adamantyl)ethyl 2-chloroacetate
2-(1-adamantyl)ethyl 2-chloroacetate (PubChem CID 585346) has the molecular formula C14H21ClO2
and a molecular weight of 256.77 g/mol. Its IUPAC name is 2-(1-adamantyl)ethyl 2-chloroacetate.
Molecular Properties
| Compound Name | 2-(1-adamantyl)ethyl 2-chloroacetate |
| PubChem CID | 585346 |
| Molecular Formula | C14H21ClO2 |
| Molecular Weight | 256.77 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-(1-adamantyl)ethyl 2-chloroacetate |
| SMILES | O=C(CCl)OCCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H21ClO2/c15-9-13(16)17-2-1-14-6-10-3-11(7-14)5-12(4-10)8-14/h10-12H,1-9H2 |
| InChIKey | FFLCLAGBCHCEFK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.77 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-adamantyl)ethyl 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantyl)ethyl 2-chloroacetate?
The IUPAC name of 2-(1-adamantyl)ethyl 2-chloroacetate (CID 585346) is 2-(1-adamantyl)ethyl 2-chloroacetate.
What is the SMILES notation for 2-(1-adamantyl)ethyl 2-chloroacetate?
The canonical SMILES for 2-(1-adamantyl)ethyl 2-chloroacetate is O=C(CCl)OCCC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 2-(1-adamantyl)ethyl 2-chloroacetate?
The InChIKey is FFLCLAGBCHCEFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21ClO2/c15-9-13(16)17-2-1-14-6-10-3-11(7-14)5-12(4-10)8-14/h10-12H,1-9H2.
What are the key properties of 2-(1-adamantyl)ethyl 2-chloroacetate?
2-(1-adamantyl)ethyl 2-chloroacetate has a molecular weight of 256.77 g/mol, XLogP of 3.37, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantyl)ethyl 2-chloroacetate is sourced from PubChem (CID 585346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).