C30H31IN2O2 — CID 58534993
[4-[(S)-(5-ethyl-1-azabicyclo[2.2.2]octan-2-yl)-(naphthalen-1-ylmethoxy)methyl]quinolin-6-yl] hypoiodite (PubChem CID 58534993) has the molecular formula C30H31IN2O2 and a molecular weight of 578.49 g/mol. Its IUPAC name is [4-[(S)-(5-ethyl-1-azabicyclo[2.2.2]octan-2-yl)-(naphthalen-1-ylmethoxy)methyl]quinolin-6-yl] hypoiodite.
| Compound Name | [4-[(S)-(5-ethyl-1-azabicyclo[2.2.2]octan-2-yl)-(naphthalen-1-ylmethoxy)methyl]quinolin-6-yl] hypoiodite |
|---|---|
| PubChem CID | 58534993 |
| Molecular Formula | C30H31IN2O2 |
| Molecular Weight | 578.49 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | [4-[(S)-(5-ethyl-1-azabicyclo[2.2.2]octan-2-yl)-(naphthalen-1-ylmethoxy)methyl]quinolin-6-yl] hypoiodite |
| SMILES | CCC1CN2CCC1CC2[C@@H](OCc1cccc2ccccc12)c1ccnc2ccc(OI)cc12 |
| InChI | InChI=1S/C30H31IN2O2/c1-2-20-18-33-15-13-22(20)16-29(33)30(26-12-14-32-28-11-10-24(35-31)17-27(26)28)34-19-23-8-5-7-21-6-3-4-9-25(21)23/h3-12,14,17,20,22,29-30H,2,13,15-16,18-19H2,1H3/t20?,22?,29?,30-/m0/s1 |
| InChIKey | GXOJGCXVNJGWOW-DXFDHYSVSA-N |
| XLogP | 7.50 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.49 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|