About 1-[2-[[1-[(1R)-1,2-dihydroacenaphthylen-1-yl]piperidin-4-yl]amino]anilino]butan-2-one
1-[2-[[1-[(1R)-1,2-dihydroacenaphthylen-1-yl]piperidin-4-yl]amino]anilino]butan-2-one (PubChem CID 58535076) has the molecular formula C27H31N3O
and a molecular weight of 413.57 g/mol. Its IUPAC name is 1-[2-[[1-[(1R)-1,2-dihydroacenaphthylen-1-yl]piperidin-4-yl]amino]anilino]butan-2-one.
Molecular Properties
| Compound Name | 1-[2-[[1-[(1R)-1,2-dihydroacenaphthylen-1-yl]piperidin-4-yl]amino]anilino]butan-2-one |
| PubChem CID | 58535076 |
| Molecular Formula | C27H31N3O |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | 1-[2-[[1-[(1R)-1,2-dihydroacenaphthylen-1-yl]piperidin-4-yl]amino]anilino]butan-2-one |
| SMILES | CCC(=O)CNc1ccccc1NC1CCN([C@@H]2Cc3cccc4cccc2c34)CC1 |
| InChI | InChI=1S/C27H31N3O/c1-2-22(31)18-28-24-11-3-4-12-25(24)29-21-13-15-30(16-14-21)26-17-20-9-5-7-19-8-6-10-23(26)27(19)20/h3-12,21,26,28-29H,2,13-18H2,1H3/t26-/m1/s1 |
| InChIKey | BRODCWAXMXOADG-AREMUKBSSA-N |
| XLogP | 5.40 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[[1-[(1R)-1,2-dihydroacenaphthylen-1-yl]piperidin-4-yl]amino]anilino]butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[[1-[(1R)-1,2-dihydroacenaphthylen-1-yl]piperidin-4-yl]amino]anilino]butan-2-one?
The IUPAC name of 1-[2-[[1-[(1R)-1,2-dihydroacenaphthylen-1-yl]piperidin-4-yl]amino]anilino]butan-2-one (CID 58535076) is 1-[2-[[1-[(1R)-1,2-dihydroacenaphthylen-1-yl]piperidin-4-yl]amino]anilino]butan-2-one.
What is the SMILES notation for 1-[2-[[1-[(1R)-1,2-dihydroacenaphthylen-1-yl]piperidin-4-yl]amino]anilino]butan-2-one?
The canonical SMILES for 1-[2-[[1-[(1R)-1,2-dihydroacenaphthylen-1-yl]piperidin-4-yl]amino]anilino]butan-2-one is CCC(=O)CNc1ccccc1NC1CCN([C@@H]2Cc3cccc4cccc2c34)CC1.
What is the InChIKey of 1-[2-[[1-[(1R)-1,2-dihydroacenaphthylen-1-yl]piperidin-4-yl]amino]anilino]butan-2-one?
The InChIKey is BRODCWAXMXOADG-AREMUKBSSA-N. The full InChI is InChI=1S/C27H31N3O/c1-2-22(31)18-28-24-11-3-4-12-25(24)29-21-13-15-30(16-14-21)26-17-20-9-5-7-19-8-6-10-23(26)27(19)20/h3-12,21,26,28-29H,2,13-18H2,1H3/t26-/m1/s1.
What are the key properties of 1-[2-[[1-[(1R)-1,2-dihydroacenaphthylen-1-yl]piperidin-4-yl]amino]anilino]butan-2-one?
1-[2-[[1-[(1R)-1,2-dihydroacenaphthylen-1-yl]piperidin-4-yl]amino]anilino]butan-2-one has a molecular weight of 413.57 g/mol, XLogP of 5.40, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[[1-[(1R)-1,2-dihydroacenaphthylen-1-yl]piperidin-4-yl]amino]anilino]butan-2-one is sourced from PubChem (CID 58535076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).