C29H34F4O3 — CID 58535298
5-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2-[2-[6-[(E)-prop-1-enyl]oxan-3-yl]ethyl]oxane (PubChem CID 58535298) has the molecular formula C29H34F4O3 and a molecular weight of 506.58 g/mol. Its IUPAC name is 5-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2-[2-[6-[(E)-prop-1-enyl]oxan-3-yl]ethyl]oxane.
| Compound Name | 5-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2-[2-[6-[(E)-prop-1-enyl]oxan-3-yl]ethyl]oxane |
|---|---|
| PubChem CID | 58535298 |
| Molecular Formula | C29H34F4O3 |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | 5-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2-[2-[6-[(E)-prop-1-enyl]oxan-3-yl]ethyl]oxane |
| SMILES | C/C=C/C1CCC(CCC2CCC(c3ccc(-c4ccc(OCC)c(F)c4F)c(F)c3F)CO2)CO1 |
| InChI | InChI=1S/C29H34F4O3/c1-3-5-20-9-6-18(16-35-20)7-10-21-11-8-19(17-36-21)22-12-13-23(27(31)26(22)30)24-14-15-25(34-4-2)29(33)28(24)32/h3,5,12-15,18-21H,4,6-11,16-17H2,1-2H3/b5-3+ |
| InChIKey | MYXHMHYRQJPRLM-HWKANZROSA-N |
| XLogP | 7.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|