C30H36F4O3 — CID 58535464
2-but-3-enyl-5-[2-[5-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]oxan-2-yl]ethyl]oxane (PubChem CID 58535464) has the molecular formula C30H36F4O3 and a molecular weight of 520.61 g/mol. Its IUPAC name is 2-but-3-enyl-5-[2-[5-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]oxan-2-yl]ethyl]oxane.
| Compound Name | 2-but-3-enyl-5-[2-[5-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]oxan-2-yl]ethyl]oxane |
|---|---|
| PubChem CID | 58535464 |
| Molecular Formula | C30H36F4O3 |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | 2-but-3-enyl-5-[2-[5-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]oxan-2-yl]ethyl]oxane |
| SMILES | C=CCCC1CCC(CCC2CCC(c3ccc(-c4ccc(OCC)c(F)c4F)c(F)c3F)CO2)CO1 |
| InChI | InChI=1S/C30H36F4O3/c1-3-5-6-21-10-7-19(17-36-21)8-11-22-12-9-20(18-37-22)23-13-14-24(28(32)27(23)31)25-15-16-26(35-4-2)30(34)29(25)33/h3,13-16,19-22H,1,4-12,17-18H2,2H3 |
| InChIKey | ZUSUUEPHRRCBDX-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|