C28H32F4O3 — CID 58535844
2-ethenyl-5-[2-[5-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]oxan-2-yl]ethyl]oxane (PubChem CID 58535844) has the molecular formula C28H32F4O3 and a molecular weight of 492.55 g/mol. Its IUPAC name is 2-ethenyl-5-[2-[5-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]oxan-2-yl]ethyl]oxane.
| Compound Name | 2-ethenyl-5-[2-[5-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]oxan-2-yl]ethyl]oxane |
|---|---|
| PubChem CID | 58535844 |
| Molecular Formula | C28H32F4O3 |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 2-ethenyl-5-[2-[5-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]oxan-2-yl]ethyl]oxane |
| SMILES | C=CC1CCC(CCC2CCC(c3ccc(-c4ccc(OCC)c(F)c4F)c(F)c3F)CO2)CO1 |
| InChI | InChI=1S/C28H32F4O3/c1-3-19-8-5-17(15-34-19)6-9-20-10-7-18(16-35-20)21-11-12-22(26(30)25(21)29)23-13-14-24(33-4-2)28(32)27(23)31/h3,11-14,17-20H,1,4-10,15-16H2,2H3 |
| InChIKey | OWPLOODTSMMVDY-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|