About 2,3-dihydrodibenzofuran
2,3-dihydrodibenzofuran (PubChem CID 58536247) has the molecular formula C12H10O
and a molecular weight of 170.21 g/mol. Its IUPAC name is 2,3-dihydrodibenzofuran.
Molecular Properties
| Compound Name | 2,3-dihydrodibenzofuran |
| PubChem CID | 58536247 |
| Molecular Formula | C12H10O |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 2,3-dihydrodibenzofuran |
| SMILES | C1=c2oc3ccccc3c2=CCC1 |
| InChI | InChI=1S/C12H10O/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1,3,5-8H,2,4H2 |
| InChIKey | REYDFZGMZDZALS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dihydrodibenzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydrodibenzofuran?
The IUPAC name of 2,3-dihydrodibenzofuran (CID 58536247) is 2,3-dihydrodibenzofuran.
What is the SMILES notation for 2,3-dihydrodibenzofuran?
The canonical SMILES for 2,3-dihydrodibenzofuran is C1=c2oc3ccccc3c2=CCC1.
What is the InChIKey of 2,3-dihydrodibenzofuran?
The InChIKey is REYDFZGMZDZALS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1,3,5-8H,2,4H2.
What are the key properties of 2,3-dihydrodibenzofuran?
2,3-dihydrodibenzofuran has a molecular weight of 170.21 g/mol, XLogP of 1.79, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrodibenzofuran is sourced from PubChem (CID 58536247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).