About (5E)-6-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]hexa-1,5-dien-3-amine
(5E)-6-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]hexa-1,5-dien-3-amine (PubChem CID 58536325) has the molecular formula C15H21N
and a molecular weight of 215.34 g/mol. Its IUPAC name is (5E)-6-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]hexa-1,5-dien-3-amine.
Molecular Properties
| Compound Name | (5E)-6-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]hexa-1,5-dien-3-amine |
| PubChem CID | 58536325 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (5E)-6-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]hexa-1,5-dien-3-amine |
| SMILES | C=CC(C/C=C/C1C=CC=CC1)N/C=C/C |
| InChI | InChI=1S/C15H21N/c1-3-13-16-15(4-2)12-8-11-14-9-6-5-7-10-14/h3-9,11,13-16H,2,10,12H2,1H3/b11-8+,13-3+ |
| InChIKey | WVOATKRUOHWTTP-DGKXCYHASA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-6-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]hexa-1,5-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-6-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]hexa-1,5-dien-3-amine?
The IUPAC name of (5E)-6-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]hexa-1,5-dien-3-amine (CID 58536325) is (5E)-6-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]hexa-1,5-dien-3-amine.
What is the SMILES notation for (5E)-6-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]hexa-1,5-dien-3-amine?
The canonical SMILES for (5E)-6-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]hexa-1,5-dien-3-amine is C=CC(C/C=C/C1C=CC=CC1)N/C=C/C.
What is the InChIKey of (5E)-6-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]hexa-1,5-dien-3-amine?
The InChIKey is WVOATKRUOHWTTP-DGKXCYHASA-N. The full InChI is InChI=1S/C15H21N/c1-3-13-16-15(4-2)12-8-11-14-9-6-5-7-10-14/h3-9,11,13-16H,2,10,12H2,1H3/b11-8+,13-3+.
What are the key properties of (5E)-6-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]hexa-1,5-dien-3-amine?
(5E)-6-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]hexa-1,5-dien-3-amine has a molecular weight of 215.34 g/mol, XLogP of 3.74, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-6-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]hexa-1,5-dien-3-amine is sourced from PubChem (CID 58536325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).