C34H23BNO2S — CID 58536384
CID 58536384 (PubChem CID 58536384) has the molecular formula C34H23BNO2S and a molecular weight of 520.44 g/mol.
| Compound Name | CID 58536384 |
|---|---|
| PubChem CID | 58536384 |
| Molecular Formula | C34H23BNO2S |
| Molecular Weight | 520.44 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | — |
| SMILES | O[B]Oc1ccc2c(c1)c1cc(-c3ccc(-c4ccc(-c5ccccc5)s4)cc3)ccc1n2-c1ccccc1 |
| InChI | InChI=1S/C34H23BNO2S/c37-35-38-28-16-18-32-30(22-28)29-21-26(15-17-31(29)36(32)27-9-5-2-6-10-27)23-11-13-25(14-12-23)34-20-19-33(39-34)24-7-3-1-4-8-24/h1-22,37H |
| InChIKey | XIXLKKOJOXJWGG-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.44 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|