C42H27N7 — CID 58536530
3,7,11-tris(4-phenylphenyl)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaene (PubChem CID 58536530) has the molecular formula C42H27N7 and a molecular weight of 629.73 g/mol. Its IUPAC name is 3,7,11-tris(4-phenylphenyl)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaene.
| Compound Name | 3,7,11-tris(4-phenylphenyl)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaene |
|---|---|
| PubChem CID | 58536530 |
| Molecular Formula | C42H27N7 |
| Molecular Weight | 629.73 g/mol |
| Exact Mass | 629.23 |
| IUPAC Name | 3,7,11-tris(4-phenylphenyl)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaene |
| SMILES | c1ccc(-c2ccc(C3=NC4=NC(c5ccc(-c6ccccc6)cc5)=NC5=NC(c6ccc(-c7ccccc7)cc6)=NC(=N3)N45)cc2)cc1 |
| InChI | InChI=1S/C42H27N7/c1-4-10-28(11-5-1)31-16-22-34(23-17-31)37-43-40-45-38(35-24-18-32(19-25-35)29-12-6-2-7-13-29)47-42-48-39(46-41(44-37)49(40)42)36-26-20-33(21-27-36)30-14-8-3-9-15-30/h1-27H |
| InChIKey | AOBFERMWLKWUMU-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 77.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.73 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |