C33H21N7 — CID 58536544
3,7,11-tris(benzimidazol-1-yl)-13-azatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaene (PubChem CID 58536544) has the molecular formula C33H21N7 and a molecular weight of 515.58 g/mol. Its IUPAC name is 3,7,11-tris(benzimidazol-1-yl)-13-azatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaene.
| Compound Name | 3,7,11-tris(benzimidazol-1-yl)-13-azatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaene |
|---|---|
| PubChem CID | 58536544 |
| Molecular Formula | C33H21N7 |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | 3,7,11-tris(benzimidazol-1-yl)-13-azatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaene |
| SMILES | C1=C2C=C(n3cnc4ccccc43)C=C3C=C(n4cnc5ccccc54)C=C(C=C1n1cnc4ccccc41)N23 |
| InChI | InChI=1S/C33H21N7/c1-4-10-31-28(7-1)34-19-37(31)22-13-25-15-23(38-20-35-29-8-2-5-11-32(29)38)17-27-18-24(16-26(14-22)40(25)27)39-21-36-30-9-3-6-12-33(30)39/h1-21H |
| InChIKey | YBPUHWZCDOMZMW-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 56.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |