methyl N-methyl-N-[2-(methylamino)ethyl]carbamate

C6H14N2O2 — CID 58537059

IUPACmethyl N-methyl-N-[2-(methylamino)ethyl]carbamate
SMILESCNCCN(C)C(=O)OC
InChIInChI=1S/C6H14N2O2/c1-7-4-5-8(2)6(9)10-3/h7H,4-5H2,1-3H3
InChIKeyCIHAWTDTDVMLKM-UHFFFAOYSA-N
MW146.19 g/mol
LogP-0.10
Rot. Bonds3

About methyl N-methyl-N-[2-(methylamino)ethyl]carbamate

methyl N-methyl-N-[2-(methylamino)ethyl]carbamate (PubChem CID 58537059) has the molecular formula C6H14N2O2 and a molecular weight of 146.19 g/mol. Its IUPAC name is methyl N-methyl-N-[2-(methylamino)ethyl]carbamate.

Molecular Properties

Compound Namemethyl N-methyl-N-[2-(methylamino)ethyl]carbamate
PubChem CID58537059
Molecular FormulaC6H14N2O2
Molecular Weight146.19 g/mol
Exact Mass146.11
IUPAC Namemethyl N-methyl-N-[2-(methylamino)ethyl]carbamate
SMILESCNCCN(C)C(=O)OC
InChIInChI=1S/C6H14N2O2/c1-7-4-5-8(2)6(9)10-3/h7H,4-5H2,1-3H3
InChIKeyCIHAWTDTDVMLKM-UHFFFAOYSA-N
XLogP-0.10
TPSA41.57 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500146.19
LogP ≤ 5-0.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl N-methyl-N-[2-(methylamino)ethyl]carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-methyl-N-[2-(methylamino)ethyl]carbamate?
The IUPAC name of methyl N-methyl-N-[2-(methylamino)ethyl]carbamate (CID 58537059) is methyl N-methyl-N-[2-(methylamino)ethyl]carbamate.
What is the SMILES notation for methyl N-methyl-N-[2-(methylamino)ethyl]carbamate?
The canonical SMILES for methyl N-methyl-N-[2-(methylamino)ethyl]carbamate is CNCCN(C)C(=O)OC.
What is the InChIKey of methyl N-methyl-N-[2-(methylamino)ethyl]carbamate?
The InChIKey is CIHAWTDTDVMLKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O2/c1-7-4-5-8(2)6(9)10-3/h7H,4-5H2,1-3H3.
What are the key properties of methyl N-methyl-N-[2-(methylamino)ethyl]carbamate?
methyl N-methyl-N-[2-(methylamino)ethyl]carbamate has a molecular weight of 146.19 g/mol, XLogP of -0.10, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-methyl-N-[2-(methylamino)ethyl]carbamate is sourced from PubChem (CID 58537059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).