About (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate
(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 58537138) has the molecular formula C16H24FN3O6
and a molecular weight of 373.38 g/mol. Its IUPAC name is (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
Molecular Properties
| Compound Name | (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| PubChem CID | 58537138 |
| Molecular Formula | C16H24FN3O6 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | CC(C)(C)OC(=O)NCCCCCC(=O)OCn1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H24FN3O6/c1-16(2,3)26-15(24)18-8-6-4-5-7-12(21)25-10-20-9-11(17)13(22)19-14(20)23/h9H,4-8,10H2,1-3H3,(H,18,24)(H,19,22,23) |
| InChIKey | ZTUHJUCDUDDXSI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate?
The IUPAC name of (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (CID 58537138) is (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
What is the SMILES notation for (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate?
The canonical SMILES for (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate is CC(C)(C)OC(=O)NCCCCCC(=O)OCn1cc(F)c(=O)[nH]c1=O.
What is the InChIKey of (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate?
The InChIKey is ZTUHJUCDUDDXSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24FN3O6/c1-16(2,3)26-15(24)18-8-6-4-5-7-12(21)25-10-20-9-11(17)13(22)19-14(20)23/h9H,4-8,10H2,1-3H3,(H,18,24)(H,19,22,23).
What are the key properties of (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate?
(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate has a molecular weight of 373.38 g/mol, XLogP of 1.26, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate is sourced from PubChem (CID 58537138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).