C23H39N3O4Si — CID 58537629
(2S,4S,5R)-5-azido-4-methyl-6-(phenylmethoxymethyl)-2-tri(propan-2-yl)silyloxyoxan-3-ol (PubChem CID 58537629) has the molecular formula C23H39N3O4Si and a molecular weight of 449.67 g/mol. Its IUPAC name is (2S,4S,5R)-5-azido-4-methyl-6-(phenylmethoxymethyl)-2-tri(propan-2-yl)silyloxyoxan-3-ol.
| Compound Name | (2S,4S,5R)-5-azido-4-methyl-6-(phenylmethoxymethyl)-2-tri(propan-2-yl)silyloxyoxan-3-ol |
|---|---|
| PubChem CID | 58537629 |
| Molecular Formula | C23H39N3O4Si |
| Molecular Weight | 449.67 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | (2S,4S,5R)-5-azido-4-methyl-6-(phenylmethoxymethyl)-2-tri(propan-2-yl)silyloxyoxan-3-ol |
| SMILES | CC(C)[Si](O[C@@H]1OC(COCc2ccccc2)[C@H](N=[N+]=[N-])[C@H](C)C1O)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H39N3O4Si/c1-15(2)31(16(3)4,17(5)6)30-23-22(27)18(7)21(25-26-24)20(29-23)14-28-13-19-11-9-8-10-12-19/h8-12,15-18,20-23,27H,13-14H2,1-7H3/t18-,20?,21+,22?,23-/m0/s1 |
| InChIKey | YZPXUWAGBYKASA-XXZAMGIKSA-N |
| XLogP | 5.80 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.67 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|