C36H42N2O9S2 — CID 58537668
2-[2-[8-(dithiolan-3-yl)-4-oxooctoxy]ethoxy]ethyl (19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl) carbonate (PubChem CID 58537668) has the molecular formula C36H42N2O9S2 and a molecular weight of 710.87 g/mol. Its IUPAC name is 2-[2-[8-(dithiolan-3-yl)-4-oxooctoxy]ethoxy]ethyl (19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl) carbonate.
| Compound Name | 2-[2-[8-(dithiolan-3-yl)-4-oxooctoxy]ethoxy]ethyl (19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl) carbonate |
|---|---|
| PubChem CID | 58537668 |
| Molecular Formula | C36H42N2O9S2 |
| Molecular Weight | 710.87 g/mol |
| Exact Mass | 710.23 |
| IUPAC Name | 2-[2-[8-(dithiolan-3-yl)-4-oxooctoxy]ethoxy]ethyl (19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl) carbonate |
| SMILES | CCC1(OC(=O)OCCOCCOCCCC(=O)CCCCC2CCSS2)C(=O)OCc2c1cc1n(c2=O)Cc2cc3ccccc3nc2-1 |
| InChI | InChI=1S/C36H42N2O9S2/c1-2-36(47-35(42)45-18-17-44-16-15-43-14-7-10-26(39)9-4-5-11-27-13-19-48-49-27)29-21-31-32-25(20-24-8-3-6-12-30(24)37-32)22-38(31)33(40)28(29)23-46-34(36)41/h3,6,8,12,20-21,27H,2,4-5,7,9-11,13-19,22-23H2,1H3 |
| InChIKey | YQIJKUFXNBQZIP-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 132.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.87 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|