C24H41NO2 — CID 58537691
[(5Z,8Z,11Z,17Z)-icosa-5,8,11,17-tetraenyl] N-propylcarbamate (PubChem CID 58537691) has the molecular formula C24H41NO2 and a molecular weight of 375.60 g/mol. Its IUPAC name is [(5Z,8Z,11Z,17Z)-icosa-5,8,11,17-tetraenyl] N-propylcarbamate.
| Compound Name | [(5Z,8Z,11Z,17Z)-icosa-5,8,11,17-tetraenyl] N-propylcarbamate |
|---|---|
| PubChem CID | 58537691 |
| Molecular Formula | C24H41NO2 |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 375.31 |
| IUPAC Name | [(5Z,8Z,11Z,17Z)-icosa-5,8,11,17-tetraenyl] N-propylcarbamate |
| SMILES | CC/C=C\CCCC/C=C\C/C=C\C/C=C\CCCCOC(=O)NCCC |
| InChI | InChI=1S/C24H41NO2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-27-24(26)25-22-4-2/h5-6,11-12,14-15,17-18H,3-4,7-10,13,16,19-23H2,1-2H3,(H,25,26)/b6-5-,12-11-,15-14-,18-17- |
| InChIKey | RWDANUAPQGWREE-GXSONNNXSA-N |
| XLogP | 7.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|