C9H15N3O3 — CID 58537994
8-methoxy-1-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 58537994) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 8-methoxy-1-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-methoxy-1-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 58537994 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 8-methoxy-1-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CON1CCC2(CC1)C(=O)NC(=O)N2C |
| InChI | InChI=1S/C9H15N3O3/c1-11-8(14)10-7(13)9(11)3-5-12(15-2)6-4-9/h3-6H2,1-2H3,(H,10,13,14) |
| InChIKey | YGHVURBCJSQNLL-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|