About 4-(methoxymethyl)-2,6-dimethylphenol
4-(methoxymethyl)-2,6-dimethylphenol (PubChem CID 585386) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 4-(methoxymethyl)-2,6-dimethylphenol.
Molecular Properties
| Compound Name | 4-(methoxymethyl)-2,6-dimethylphenol |
| PubChem CID | 585386 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 4-(methoxymethyl)-2,6-dimethylphenol |
| SMILES | COCc1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C10H14O2/c1-7-4-9(6-12-3)5-8(2)10(7)11/h4-5,11H,6H2,1-3H3 |
| InChIKey | QYYDUDRFMJMOSJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(methoxymethyl)-2,6-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methoxymethyl)-2,6-dimethylphenol?
The IUPAC name of 4-(methoxymethyl)-2,6-dimethylphenol (CID 585386) is 4-(methoxymethyl)-2,6-dimethylphenol.
What is the SMILES notation for 4-(methoxymethyl)-2,6-dimethylphenol?
The canonical SMILES for 4-(methoxymethyl)-2,6-dimethylphenol is COCc1cc(C)c(O)c(C)c1.
What is the InChIKey of 4-(methoxymethyl)-2,6-dimethylphenol?
The InChIKey is QYYDUDRFMJMOSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-7-4-9(6-12-3)5-8(2)10(7)11/h4-5,11H,6H2,1-3H3.
What are the key properties of 4-(methoxymethyl)-2,6-dimethylphenol?
4-(methoxymethyl)-2,6-dimethylphenol has a molecular weight of 166.22 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methoxymethyl)-2,6-dimethylphenol is sourced from PubChem (CID 585386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).