C27H31BClNO5 — CID 58539480
1-(2-chlorophenyl)ethyl 2-[3-methyl-5-[4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]phenyl]-1,2-oxazol-4-yl]acetate (PubChem CID 58539480) has the molecular formula C27H31BClNO5 and a molecular weight of 495.81 g/mol. Its IUPAC name is 1-(2-chlorophenyl)ethyl 2-[3-methyl-5-[4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]phenyl]-1,2-oxazol-4-yl]acetate.
| Compound Name | 1-(2-chlorophenyl)ethyl 2-[3-methyl-5-[4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]phenyl]-1,2-oxazol-4-yl]acetate |
|---|---|
| PubChem CID | 58539480 |
| Molecular Formula | C27H31BClNO5 |
| Molecular Weight | 495.81 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 1-(2-chlorophenyl)ethyl 2-[3-methyl-5-[4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]phenyl]-1,2-oxazol-4-yl]acetate |
| SMILES | Cc1noc(-c2ccc(CB3OC(C)(C)C(C)(C)O3)cc2)c1CC(=O)OC(C)c1ccccc1Cl |
| InChI | InChI=1S/C27H31BClNO5/c1-17-22(15-24(31)32-18(2)21-9-7-8-10-23(21)29)25(33-30-17)20-13-11-19(12-14-20)16-28-34-26(3,4)27(5,6)35-28/h7-14,18H,15-16H2,1-6H3 |
| InChIKey | DYTDVTDEHRTORK-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.81 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|