About [(1R)-1-(2-fluorophenyl)ethyl] 2-[3-methyl-5-[4-(2H-tetrazol-5-yl)phenyl]-1,2-oxazol-4-yl]acetate
[(1R)-1-(2-fluorophenyl)ethyl] 2-[3-methyl-5-[4-(2H-tetrazol-5-yl)phenyl]-1,2-oxazol-4-yl]acetate (PubChem CID 58539570) has the molecular formula C21H18FN5O3
and a molecular weight of 407.41 g/mol. Its IUPAC name is [(1R)-1-(2-fluorophenyl)ethyl] 2-[3-methyl-5-[4-(2H-tetrazol-5-yl)phenyl]-1,2-oxazol-4-yl]acetate.
Molecular Properties
| Compound Name | [(1R)-1-(2-fluorophenyl)ethyl] 2-[3-methyl-5-[4-(2H-tetrazol-5-yl)phenyl]-1,2-oxazol-4-yl]acetate |
| PubChem CID | 58539570 |
| Molecular Formula | C21H18FN5O3 |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | [(1R)-1-(2-fluorophenyl)ethyl] 2-[3-methyl-5-[4-(2H-tetrazol-5-yl)phenyl]-1,2-oxazol-4-yl]acetate |
| SMILES | Cc1noc(-c2ccc(-c3nn[nH]n3)cc2)c1CC(=O)O[C@H](C)c1ccccc1F |
| InChI | InChI=1S/C21H18FN5O3/c1-12-17(11-19(28)29-13(2)16-5-3-4-6-18(16)22)20(30-25-12)14-7-9-15(10-8-14)21-23-26-27-24-21/h3-10,13H,11H2,1-2H3,(H,23,24,26,27)/t13-/m1/s1 |
| InChIKey | LKUORIMDMDGAGT-CYBMUJFWSA-N |
| XLogP | 3.82 |
| TPSA | 106.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(1R)-1-(2-fluorophenyl)ethyl] 2-[3-methyl-5-[4-(2H-tetrazol-5-yl)phenyl]-1,2-oxazol-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-(2-fluorophenyl)ethyl] 2-[3-methyl-5-[4-(2H-tetrazol-5-yl)phenyl]-1,2-oxazol-4-yl]acetate?
The IUPAC name of [(1R)-1-(2-fluorophenyl)ethyl] 2-[3-methyl-5-[4-(2H-tetrazol-5-yl)phenyl]-1,2-oxazol-4-yl]acetate (CID 58539570) is [(1R)-1-(2-fluorophenyl)ethyl] 2-[3-methyl-5-[4-(2H-tetrazol-5-yl)phenyl]-1,2-oxazol-4-yl]acetate.
What is the SMILES notation for [(1R)-1-(2-fluorophenyl)ethyl] 2-[3-methyl-5-[4-(2H-tetrazol-5-yl)phenyl]-1,2-oxazol-4-yl]acetate?
The canonical SMILES for [(1R)-1-(2-fluorophenyl)ethyl] 2-[3-methyl-5-[4-(2H-tetrazol-5-yl)phenyl]-1,2-oxazol-4-yl]acetate is Cc1noc(-c2ccc(-c3nn[nH]n3)cc2)c1CC(=O)O[C@H](C)c1ccccc1F.
What is the InChIKey of [(1R)-1-(2-fluorophenyl)ethyl] 2-[3-methyl-5-[4-(2H-tetrazol-5-yl)phenyl]-1,2-oxazol-4-yl]acetate?
The InChIKey is LKUORIMDMDGAGT-CYBMUJFWSA-N. The full InChI is InChI=1S/C21H18FN5O3/c1-12-17(11-19(28)29-13(2)16-5-3-4-6-18(16)22)20(30-25-12)14-7-9-15(10-8-14)21-23-26-27-24-21/h3-10,13H,11H2,1-2H3,(H,23,24,26,27)/t13-/m1/s1.
What are the key properties of [(1R)-1-(2-fluorophenyl)ethyl] 2-[3-methyl-5-[4-(2H-tetrazol-5-yl)phenyl]-1,2-oxazol-4-yl]acetate?
[(1R)-1-(2-fluorophenyl)ethyl] 2-[3-methyl-5-[4-(2H-tetrazol-5-yl)phenyl]-1,2-oxazol-4-yl]acetate has a molecular weight of 407.41 g/mol, XLogP of 3.82, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-(2-fluorophenyl)ethyl] 2-[3-methyl-5-[4-(2H-tetrazol-5-yl)phenyl]-1,2-oxazol-4-yl]acetate is sourced from PubChem (CID 58539570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).