About 2-tert-butyl-5,5-dimethyl-4,6-dihydrocyclopenta[b]thiophen-4-ol
2-tert-butyl-5,5-dimethyl-4,6-dihydrocyclopenta[b]thiophen-4-ol (PubChem CID 58540091) has the molecular formula C13H20OS
and a molecular weight of 224.37 g/mol. Its IUPAC name is 2-tert-butyl-5,5-dimethyl-4,6-dihydrocyclopenta[b]thiophen-4-ol.
Molecular Properties
| Compound Name | 2-tert-butyl-5,5-dimethyl-4,6-dihydrocyclopenta[b]thiophen-4-ol |
| PubChem CID | 58540091 |
| Molecular Formula | C13H20OS |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2-tert-butyl-5,5-dimethyl-4,6-dihydrocyclopenta[b]thiophen-4-ol |
| SMILES | CC(C)(C)c1cc2c(s1)CC(C)(C)C2O |
| InChI | InChI=1S/C13H20OS/c1-12(2,3)10-6-8-9(15-10)7-13(4,5)11(8)14/h6,11,14H,7H2,1-5H3 |
| InChIKey | DVYSRKVSQFTFBL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-5,5-dimethyl-4,6-dihydrocyclopenta[b]thiophen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5,5-dimethyl-4,6-dihydrocyclopenta[b]thiophen-4-ol?
The IUPAC name of 2-tert-butyl-5,5-dimethyl-4,6-dihydrocyclopenta[b]thiophen-4-ol (CID 58540091) is 2-tert-butyl-5,5-dimethyl-4,6-dihydrocyclopenta[b]thiophen-4-ol.
What is the SMILES notation for 2-tert-butyl-5,5-dimethyl-4,6-dihydrocyclopenta[b]thiophen-4-ol?
The canonical SMILES for 2-tert-butyl-5,5-dimethyl-4,6-dihydrocyclopenta[b]thiophen-4-ol is CC(C)(C)c1cc2c(s1)CC(C)(C)C2O.
What is the InChIKey of 2-tert-butyl-5,5-dimethyl-4,6-dihydrocyclopenta[b]thiophen-4-ol?
The InChIKey is DVYSRKVSQFTFBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20OS/c1-12(2,3)10-6-8-9(15-10)7-13(4,5)11(8)14/h6,11,14H,7H2,1-5H3.
What are the key properties of 2-tert-butyl-5,5-dimethyl-4,6-dihydrocyclopenta[b]thiophen-4-ol?
2-tert-butyl-5,5-dimethyl-4,6-dihydrocyclopenta[b]thiophen-4-ol has a molecular weight of 224.37 g/mol, XLogP of 3.66, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5,5-dimethyl-4,6-dihydrocyclopenta[b]thiophen-4-ol is sourced from PubChem (CID 58540091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).