C31H47N7O3Si — CID 58540342
4-tert-butyl-N-[1-[5-[(1,5-dimethylpyrazol-3-yl)amino]-6-oxo-1-(2-trimethylsilylethoxymethyl)pyridazin-3-yl]piperidin-3-yl]benzamide (PubChem CID 58540342) has the molecular formula C31H47N7O3Si and a molecular weight of 593.85 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-[5-[(1,5-dimethylpyrazol-3-yl)amino]-6-oxo-1-(2-trimethylsilylethoxymethyl)pyridazin-3-yl]piperidin-3-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[1-[5-[(1,5-dimethylpyrazol-3-yl)amino]-6-oxo-1-(2-trimethylsilylethoxymethyl)pyridazin-3-yl]piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 58540342 |
| Molecular Formula | C31H47N7O3Si |
| Molecular Weight | 593.85 g/mol |
| Exact Mass | 593.35 |
| IUPAC Name | 4-tert-butyl-N-[1-[5-[(1,5-dimethylpyrazol-3-yl)amino]-6-oxo-1-(2-trimethylsilylethoxymethyl)pyridazin-3-yl]piperidin-3-yl]benzamide |
| SMILES | Cc1cc(Nc2cc(N3CCCC(NC(=O)c4ccc(C(C)(C)C)cc4)C3)nn(COCC[Si](C)(C)C)c2=O)nn1C |
| InChI | InChI=1S/C31H47N7O3Si/c1-22-18-27(34-36(22)5)33-26-19-28(35-38(30(26)40)21-41-16-17-42(6,7)8)37-15-9-10-25(20-37)32-29(39)23-11-13-24(14-12-23)31(2,3)4/h11-14,18-19,25H,9-10,15-17,20-21H2,1-8H3,(H,32,39)(H,33,34) |
| InChIKey | RYPNUUCHKRVHKL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.85 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|