About 2-propan-2-yl-4,5,6,7-tetrahydro-3H-isoindol-1-one
2-propan-2-yl-4,5,6,7-tetrahydro-3H-isoindol-1-one (PubChem CID 58540446) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 2-propan-2-yl-4,5,6,7-tetrahydro-3H-isoindol-1-one.
Molecular Properties
| Compound Name | 2-propan-2-yl-4,5,6,7-tetrahydro-3H-isoindol-1-one |
| PubChem CID | 58540446 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 2-propan-2-yl-4,5,6,7-tetrahydro-3H-isoindol-1-one |
| SMILES | CC(C)N1CC2=C(CCCC2)C1=O |
| InChI | InChI=1S/C11H17NO/c1-8(2)12-7-9-5-3-4-6-10(9)11(12)13/h8H,3-7H2,1-2H3 |
| InChIKey | VPPRIHLVNMTOEE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-propan-2-yl-4,5,6,7-tetrahydro-3H-isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-4,5,6,7-tetrahydro-3H-isoindol-1-one?
The IUPAC name of 2-propan-2-yl-4,5,6,7-tetrahydro-3H-isoindol-1-one (CID 58540446) is 2-propan-2-yl-4,5,6,7-tetrahydro-3H-isoindol-1-one.
What is the SMILES notation for 2-propan-2-yl-4,5,6,7-tetrahydro-3H-isoindol-1-one?
The canonical SMILES for 2-propan-2-yl-4,5,6,7-tetrahydro-3H-isoindol-1-one is CC(C)N1CC2=C(CCCC2)C1=O.
What is the InChIKey of 2-propan-2-yl-4,5,6,7-tetrahydro-3H-isoindol-1-one?
The InChIKey is VPPRIHLVNMTOEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-8(2)12-7-9-5-3-4-6-10(9)11(12)13/h8H,3-7H2,1-2H3.
What are the key properties of 2-propan-2-yl-4,5,6,7-tetrahydro-3H-isoindol-1-one?
2-propan-2-yl-4,5,6,7-tetrahydro-3H-isoindol-1-one has a molecular weight of 179.26 g/mol, XLogP of 2.11, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-4,5,6,7-tetrahydro-3H-isoindol-1-one is sourced from PubChem (CID 58540446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).