C14H24 — CID 585406
7a-methyl-3-(2-methylpropyl)-1,2,4,5,6,7-hexahydroindene (PubChem CID 585406) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 7a-methyl-3-(2-methylpropyl)-1,2,4,5,6,7-hexahydroindene.
| Compound Name | 7a-methyl-3-(2-methylpropyl)-1,2,4,5,6,7-hexahydroindene |
|---|---|
| PubChem CID | 585406 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 7a-methyl-3-(2-methylpropyl)-1,2,4,5,6,7-hexahydroindene |
| SMILES | CC(C)CC1=C2CCCCC2(C)CC1 |
| InChI | InChI=1S/C14H24/c1-11(2)10-12-7-9-14(3)8-5-4-6-13(12)14/h11H,4-10H2,1-3H3 |
| InChIKey | BPTHDNDBUOBTAC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|