C19H17FN2O3S — CID 58541325
1-[5-amino-2-(2-fluoro-6-methoxyphenoxy)phenyl]-3-(1,3-thiazol-2-yl)propan-2-one (PubChem CID 58541325) has the molecular formula C19H17FN2O3S and a molecular weight of 372.42 g/mol. Its IUPAC name is 1-[5-amino-2-(2-fluoro-6-methoxyphenoxy)phenyl]-3-(1,3-thiazol-2-yl)propan-2-one.
| Compound Name | 1-[5-amino-2-(2-fluoro-6-methoxyphenoxy)phenyl]-3-(1,3-thiazol-2-yl)propan-2-one |
|---|---|
| PubChem CID | 58541325 |
| Molecular Formula | C19H17FN2O3S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 1-[5-amino-2-(2-fluoro-6-methoxyphenoxy)phenyl]-3-(1,3-thiazol-2-yl)propan-2-one |
| SMILES | COc1cccc(F)c1Oc1ccc(N)cc1CC(=O)Cc1nccs1 |
| InChI | InChI=1S/C19H17FN2O3S/c1-24-17-4-2-3-15(20)19(17)25-16-6-5-13(21)9-12(16)10-14(23)11-18-22-7-8-26-18/h2-9H,10-11,21H2,1H3 |
| InChIKey | WLIAOTNHCNCCBR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|