C11H10FN3O2 — CID 58541909
methyl 5-fluoro-2-(2-methyl-1,2,4-triazol-3-yl)benzoate (PubChem CID 58541909) has the molecular formula C11H10FN3O2 and a molecular weight of 235.22 g/mol. Its IUPAC name is methyl 5-fluoro-2-(2-methyl-1,2,4-triazol-3-yl)benzoate.
| Compound Name | methyl 5-fluoro-2-(2-methyl-1,2,4-triazol-3-yl)benzoate |
|---|---|
| PubChem CID | 58541909 |
| Molecular Formula | C11H10FN3O2 |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | methyl 5-fluoro-2-(2-methyl-1,2,4-triazol-3-yl)benzoate |
| SMILES | COC(=O)c1cc(F)ccc1-c1ncnn1C |
| InChI | InChI=1S/C11H10FN3O2/c1-15-10(13-6-14-15)8-4-3-7(12)5-9(8)11(16)17-2/h3-6H,1-2H3 |
| InChIKey | LRTNXEWYDOZRDL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |