C32H37F2N7O4S — CID 58542171
[2-(1,1-difluoroethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-[4-[[4-[4-[(1,1-dioxothiolan-3-yl)methoxy]indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]methanone (PubChem CID 58542171) has the molecular formula C32H37F2N7O4S and a molecular weight of 653.76 g/mol. Its IUPAC name is [2-(1,1-difluoroethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-[4-[[4-[4-[(1,1-dioxothiolan-3-yl)methoxy]indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]methanone.
| Compound Name | [2-(1,1-difluoroethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-[4-[[4-[4-[(1,1-dioxothiolan-3-yl)methoxy]indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]methanone |
|---|---|
| PubChem CID | 58542171 |
| Molecular Formula | C32H37F2N7O4S |
| Molecular Weight | 653.76 g/mol |
| Exact Mass | 653.26 |
| IUPAC Name | [2-(1,1-difluoroethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-[4-[[4-[4-[(1,1-dioxothiolan-3-yl)methoxy]indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]methanone |
| SMILES | CC(F)(F)c1cn2c(n1)CN(C(=O)C1CCC(Nc3nccc(-n4ccc5c(OCC6CCS(=O)(=O)C6)cccc54)n3)CC1)CC2 |
| InChI | InChI=1S/C32H37F2N7O4S/c1-32(33,34)27-17-39-14-15-40(18-29(39)37-27)30(42)22-5-7-23(8-6-22)36-31-35-12-9-28(38-31)41-13-10-24-25(41)3-2-4-26(24)45-19-21-11-16-46(43,44)20-21/h2-4,9-10,12-13,17,21-23H,5-8,11,14-16,18-20H2,1H3,(H,35,36,38) |
| InChIKey | WZNWSGDMJXOWLU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 124.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.76 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |