C12H23NO — CID 58542277
N-(1-ethylcyclopentyl)-2,2-dimethylpropanamide (PubChem CID 58542277) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is N-(1-ethylcyclopentyl)-2,2-dimethylpropanamide.
| Compound Name | N-(1-ethylcyclopentyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 58542277 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | N-(1-ethylcyclopentyl)-2,2-dimethylpropanamide |
| SMILES | CCC1(NC(=O)C(C)(C)C)CCCC1 |
| InChI | InChI=1S/C12H23NO/c1-5-12(8-6-7-9-12)13-10(14)11(2,3)4/h5-9H2,1-4H3,(H,13,14) |
| InChIKey | JBRJUBNMDBWZCC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |