About (6R)-7-benzyl-6-methyl-4,7-diazaspiro[2.5]octane-5,8-dione
(6R)-7-benzyl-6-methyl-4,7-diazaspiro[2.5]octane-5,8-dione (PubChem CID 58542438) has the molecular formula C14H16N2O2
and a molecular weight of 244.29 g/mol. Its IUPAC name is (6R)-7-benzyl-6-methyl-4,7-diazaspiro[2.5]octane-5,8-dione.
Molecular Properties
| Compound Name | (6R)-7-benzyl-6-methyl-4,7-diazaspiro[2.5]octane-5,8-dione |
| PubChem CID | 58542438 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (6R)-7-benzyl-6-methyl-4,7-diazaspiro[2.5]octane-5,8-dione |
| SMILES | C[C@@H]1C(=O)NC2(CC2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C14H16N2O2/c1-10-12(17)15-14(7-8-14)13(18)16(10)9-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3,(H,15,17)/t10-/m1/s1 |
| InChIKey | DHWUSQGQUPLQLZ-SNVBAGLBSA-N |
| XLogP | 1.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6R)-7-benzyl-6-methyl-4,7-diazaspiro[2.5]octane-5,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-7-benzyl-6-methyl-4,7-diazaspiro[2.5]octane-5,8-dione?
The IUPAC name of (6R)-7-benzyl-6-methyl-4,7-diazaspiro[2.5]octane-5,8-dione (CID 58542438) is (6R)-7-benzyl-6-methyl-4,7-diazaspiro[2.5]octane-5,8-dione.
What is the SMILES notation for (6R)-7-benzyl-6-methyl-4,7-diazaspiro[2.5]octane-5,8-dione?
The canonical SMILES for (6R)-7-benzyl-6-methyl-4,7-diazaspiro[2.5]octane-5,8-dione is C[C@@H]1C(=O)NC2(CC2)C(=O)N1Cc1ccccc1.
What is the InChIKey of (6R)-7-benzyl-6-methyl-4,7-diazaspiro[2.5]octane-5,8-dione?
The InChIKey is DHWUSQGQUPLQLZ-SNVBAGLBSA-N. The full InChI is InChI=1S/C14H16N2O2/c1-10-12(17)15-14(7-8-14)13(18)16(10)9-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3,(H,15,17)/t10-/m1/s1.
What are the key properties of (6R)-7-benzyl-6-methyl-4,7-diazaspiro[2.5]octane-5,8-dione?
(6R)-7-benzyl-6-methyl-4,7-diazaspiro[2.5]octane-5,8-dione has a molecular weight of 244.29 g/mol, XLogP of 1.07, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-7-benzyl-6-methyl-4,7-diazaspiro[2.5]octane-5,8-dione is sourced from PubChem (CID 58542438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).