About ethyl 1-methyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxylate
ethyl 1-methyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxylate (PubChem CID 58542549) has the molecular formula C9H8F6N2O2
and a molecular weight of 290.16 g/mol. Its IUPAC name is ethyl 1-methyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-methyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxylate |
| PubChem CID | 58542549 |
| Molecular Formula | C9H8F6N2O2 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | ethyl 1-methyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1c(C(F)(F)F)c(C(F)(F)F)nn1C |
| InChI | InChI=1S/C9H8F6N2O2/c1-3-19-7(18)5-4(8(10,11)12)6(9(13,14)15)16-17(5)2/h3H2,1-2H3 |
| InChIKey | PDXXSKIOSOSILC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 1-methyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-methyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxylate?
The IUPAC name of ethyl 1-methyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxylate (CID 58542549) is ethyl 1-methyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxylate.
What is the SMILES notation for ethyl 1-methyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxylate?
The canonical SMILES for ethyl 1-methyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxylate is CCOC(=O)c1c(C(F)(F)F)c(C(F)(F)F)nn1C.
What is the InChIKey of ethyl 1-methyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxylate?
The InChIKey is PDXXSKIOSOSILC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F6N2O2/c1-3-19-7(18)5-4(8(10,11)12)6(9(13,14)15)16-17(5)2/h3H2,1-2H3.
What are the key properties of ethyl 1-methyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxylate?
ethyl 1-methyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxylate has a molecular weight of 290.16 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-methyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxylate is sourced from PubChem (CID 58542549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).