C9H7F5N2O2 — CID 58542553
4,6-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)pyrimidine-5-carboxylic acid (PubChem CID 58542553) has the molecular formula C9H7F5N2O2 and a molecular weight of 270.16 g/mol. Its IUPAC name is 4,6-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)pyrimidine-5-carboxylic acid.
| Compound Name | 4,6-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 58542553 |
| Molecular Formula | C9H7F5N2O2 |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 4,6-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)pyrimidine-5-carboxylic acid |
| SMILES | Cc1nc(C(F)(F)C(F)(F)F)nc(C)c1C(=O)O |
| InChI | InChI=1S/C9H7F5N2O2/c1-3-5(6(17)18)4(2)16-7(15-3)8(10,11)9(12,13)14/h1-2H3,(H,17,18) |
| InChIKey | MUUSRIKUXCFVBH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|