C14H10F8N2S — CID 58542570
5-benzylsulfanyl-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole (PubChem CID 58542570) has the molecular formula C14H10F8N2S and a molecular weight of 390.30 g/mol. Its IUPAC name is 5-benzylsulfanyl-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole.
| Compound Name | 5-benzylsulfanyl-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 58542570 |
| Molecular Formula | C14H10F8N2S |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 5-benzylsulfanyl-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole |
| SMILES | Cn1nc(C(F)(F)C(F)(F)F)c(C(F)(F)F)c1SCc1ccccc1 |
| InChI | InChI=1S/C14H10F8N2S/c1-24-11(25-7-8-5-3-2-4-6-8)9(13(17,18)19)10(23-24)12(15,16)14(20,21)22/h2-6H,7H2,1H3 |
| InChIKey | CLJZMOWHDQFGTA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|