C10H8F8N2O2 — CID 58542575
3-(1,1,2,2,2-pentafluoroethyl)-1-propan-2-yl-4-(trifluoromethyl)pyrazole-5-carboxylic acid (PubChem CID 58542575) has the molecular formula C10H8F8N2O2 and a molecular weight of 340.17 g/mol. Its IUPAC name is 3-(1,1,2,2,2-pentafluoroethyl)-1-propan-2-yl-4-(trifluoromethyl)pyrazole-5-carboxylic acid.
| Compound Name | 3-(1,1,2,2,2-pentafluoroethyl)-1-propan-2-yl-4-(trifluoromethyl)pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 58542575 |
| Molecular Formula | C10H8F8N2O2 |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 3-(1,1,2,2,2-pentafluoroethyl)-1-propan-2-yl-4-(trifluoromethyl)pyrazole-5-carboxylic acid |
| SMILES | CC(C)n1nc(C(F)(F)C(F)(F)F)c(C(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C10H8F8N2O2/c1-3(2)20-5(7(21)22)4(9(13,14)15)6(19-20)8(11,12)10(16,17)18/h3H,1-2H3,(H,21,22) |
| InChIKey | OAFNBTKAYNAGHD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|