1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid

C7H7F3N2O3 — CID 58542590

IUPAC1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid
SMILESCn1nc(OCC(F)(F)F)cc1C(=O)O
InChIInChI=1S/C7H7F3N2O3/c1-12-4(6(13)14)2-5(11-12)15-3-7(8,9)10/h2H,3H2,1H3,(H,13,14)
InChIKeyFMGOQXKOLOLYDP-UHFFFAOYSA-N
MW224.14 g/mol
LogP1.06
Rot. Bonds3

About 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid

1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid (PubChem CID 58542590) has the molecular formula C7H7F3N2O3 and a molecular weight of 224.14 g/mol. Its IUPAC name is 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid.

Molecular Properties

Compound Name1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid
PubChem CID58542590
Molecular FormulaC7H7F3N2O3
Molecular Weight224.14 g/mol
Exact Mass224.04
IUPAC Name1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid
SMILESCn1nc(OCC(F)(F)F)cc1C(=O)O
InChIInChI=1S/C7H7F3N2O3/c1-12-4(6(13)14)2-5(11-12)15-3-7(8,9)10/h2H,3H2,1H3,(H,13,14)
InChIKeyFMGOQXKOLOLYDP-UHFFFAOYSA-N
XLogP1.06
TPSA64.35 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.14
LogP ≤ 51.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid?
The IUPAC name of 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid (CID 58542590) is 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid.
What is the SMILES notation for 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid?
The canonical SMILES for 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid is Cn1nc(OCC(F)(F)F)cc1C(=O)O.
What is the InChIKey of 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid?
The InChIKey is FMGOQXKOLOLYDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F3N2O3/c1-12-4(6(13)14)2-5(11-12)15-3-7(8,9)10/h2H,3H2,1H3,(H,13,14).
What are the key properties of 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid?
1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid has a molecular weight of 224.14 g/mol, XLogP of 1.06, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid is sourced from PubChem (CID 58542590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).