About 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid
1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid (PubChem CID 58542590) has the molecular formula C7H7F3N2O3
and a molecular weight of 224.14 g/mol. Its IUPAC name is 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid |
| PubChem CID | 58542590 |
| Molecular Formula | C7H7F3N2O3 |
| Molecular Weight | 224.14 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid |
| SMILES | Cn1nc(OCC(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C7H7F3N2O3/c1-12-4(6(13)14)2-5(11-12)15-3-7(8,9)10/h2H,3H2,1H3,(H,13,14) |
| InChIKey | FMGOQXKOLOLYDP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.14 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid?
The IUPAC name of 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid (CID 58542590) is 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid.
What is the SMILES notation for 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid?
The canonical SMILES for 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid is Cn1nc(OCC(F)(F)F)cc1C(=O)O.
What is the InChIKey of 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid?
The InChIKey is FMGOQXKOLOLYDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F3N2O3/c1-12-4(6(13)14)2-5(11-12)15-3-7(8,9)10/h2H,3H2,1H3,(H,13,14).
What are the key properties of 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid?
1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid has a molecular weight of 224.14 g/mol, XLogP of 1.06, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid is sourced from PubChem (CID 58542590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).