C31H55IO4Si — CID 58542621
(4S,7R,8S,9S,13Z,16S)-4-[tert-butyl(dimethyl)silyl]oxy-13-ethyl-16-[(E)-1-iodoprop-1-en-2-yl]-5,5,7,8,9-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 58542621) has the molecular formula C31H55IO4Si and a molecular weight of 646.77 g/mol. Its IUPAC name is (4S,7R,8S,9S,13Z,16S)-4-[tert-butyl(dimethyl)silyl]oxy-13-ethyl-16-[(E)-1-iodoprop-1-en-2-yl]-5,5,7,8,9-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,13Z,16S)-4-[tert-butyl(dimethyl)silyl]oxy-13-ethyl-16-[(E)-1-iodoprop-1-en-2-yl]-5,5,7,8,9-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 58542621 |
| Molecular Formula | C31H55IO4Si |
| Molecular Weight | 646.77 g/mol |
| Exact Mass | 646.29 |
| IUPAC Name | (4S,7R,8S,9S,13Z,16S)-4-[tert-butyl(dimethyl)silyl]oxy-13-ethyl-16-[(E)-1-iodoprop-1-en-2-yl]-5,5,7,8,9-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | CC/C1=C/C[C@@H](/C(C)=C/I)OC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C(=O)[C@H](C)[C@@H](C)[C@@H](C)CCC1 |
| InChI | InChI=1S/C31H55IO4Si/c1-13-25-16-14-15-21(2)23(4)24(5)29(34)31(9,10)27(36-37(11,12)30(6,7)8)19-28(33)35-26(18-17-25)22(3)20-32/h17,20-21,23-24,26-27H,13-16,18-19H2,1-12H3/b22-20+,25-17-/t21-,23-,24+,26-,27-/m0/s1 |
| InChIKey | YCTCTXNMNZWHOE-ZVMPGHLMSA-N |
| XLogP | 9.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.77 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|