C24H37NO6 — CID 58542622
(E)-3-[(1S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-5,9-dioxo-4,17-dioxabicyclo[14.1.0]heptadecan-3-yl]but-2-enenitrile (PubChem CID 58542622) has the molecular formula C24H37NO6 and a molecular weight of 435.56 g/mol. Its IUPAC name is (E)-3-[(1S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-5,9-dioxo-4,17-dioxabicyclo[14.1.0]heptadecan-3-yl]but-2-enenitrile.
| Compound Name | (E)-3-[(1S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-5,9-dioxo-4,17-dioxabicyclo[14.1.0]heptadecan-3-yl]but-2-enenitrile |
|---|---|
| PubChem CID | 58542622 |
| Molecular Formula | C24H37NO6 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | (E)-3-[(1S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-5,9-dioxo-4,17-dioxabicyclo[14.1.0]heptadecan-3-yl]but-2-enenitrile |
| SMILES | C/C(=C\C#N)[C@@H]1C[C@@H]2O[C@]2(C)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C24H37NO6/c1-14(9-11-25)17-12-19-24(6,31-19)10-7-8-15(2)21(28)16(3)22(29)23(4,5)18(26)13-20(27)30-17/h9,15-19,21,26,28H,7-8,10,12-13H2,1-6H3/b14-9+/t15-,16+,17-,18-,19-,21-,24+/m0/s1 |
| InChIKey | GENBOTXVZQZWKG-JHDGAHBMSA-N |
| XLogP | 3.08 |
| TPSA | 120.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|