C22H41IO3Si — CID 58542627
methyl (2Z,6R)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpent-4-enylidene]-6-methyloctanoate (PubChem CID 58542627) has the molecular formula C22H41IO3Si and a molecular weight of 508.56 g/mol. Its IUPAC name is methyl (2Z,6R)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpent-4-enylidene]-6-methyloctanoate.
| Compound Name | methyl (2Z,6R)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpent-4-enylidene]-6-methyloctanoate |
|---|---|
| PubChem CID | 58542627 |
| Molecular Formula | C22H41IO3Si |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | methyl (2Z,6R)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpent-4-enylidene]-6-methyloctanoate |
| SMILES | CC[C@@H](C)CCC/C(=C/C[C@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/I)C(=O)OC |
| InChI | InChI=1S/C22H41IO3Si/c1-10-17(2)12-11-13-19(21(24)25-7)14-15-20(18(3)16-23)26-27(8,9)22(4,5)6/h14,16-17,20H,10-13,15H2,1-9H3/b18-16+,19-14-/t17-,20+/m1/s1 |
| InChIKey | WMJDEZOXYDCARK-FNUNTFBHSA-N |
| XLogP | 7.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|