About 7-[1-(2,4-difluorophenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]ethyl]quinolin-8-ol
7-[1-(2,4-difluorophenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]ethyl]quinolin-8-ol (PubChem CID 58542665) has the molecular formula C23H15F5N2O
and a molecular weight of 430.38 g/mol. Its IUPAC name is 7-[1-(2,4-difluorophenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]ethyl]quinolin-8-ol.
Molecular Properties
| Compound Name | 7-[1-(2,4-difluorophenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]ethyl]quinolin-8-ol |
| PubChem CID | 58542665 |
| Molecular Formula | C23H15F5N2O |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 7-[1-(2,4-difluorophenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]ethyl]quinolin-8-ol |
| SMILES | Oc1c(C(Cc2ccc(C(F)(F)F)cn2)c2ccc(F)cc2F)ccc2cccnc12 |
| InChI | InChI=1S/C23H15F5N2O/c24-15-5-8-17(20(25)10-15)19(11-16-6-4-14(12-30-16)23(26,27)28)18-7-3-13-2-1-9-29-21(13)22(18)31/h1-10,12,19,31H,11H2 |
| InChIKey | ACULMAVHJBHENX-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-[1-(2,4-difluorophenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]ethyl]quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[1-(2,4-difluorophenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]ethyl]quinolin-8-ol?
The IUPAC name of 7-[1-(2,4-difluorophenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]ethyl]quinolin-8-ol (CID 58542665) is 7-[1-(2,4-difluorophenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]ethyl]quinolin-8-ol.
What is the SMILES notation for 7-[1-(2,4-difluorophenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]ethyl]quinolin-8-ol?
The canonical SMILES for 7-[1-(2,4-difluorophenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]ethyl]quinolin-8-ol is Oc1c(C(Cc2ccc(C(F)(F)F)cn2)c2ccc(F)cc2F)ccc2cccnc12.
What is the InChIKey of 7-[1-(2,4-difluorophenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]ethyl]quinolin-8-ol?
The InChIKey is ACULMAVHJBHENX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15F5N2O/c24-15-5-8-17(20(25)10-15)19(11-16-6-4-14(12-30-16)23(26,27)28)18-7-3-13-2-1-9-29-21(13)22(18)31/h1-10,12,19,31H,11H2.
What are the key properties of 7-[1-(2,4-difluorophenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]ethyl]quinolin-8-ol?
7-[1-(2,4-difluorophenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]ethyl]quinolin-8-ol has a molecular weight of 430.38 g/mol, XLogP of 6.01, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[1-(2,4-difluorophenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]ethyl]quinolin-8-ol is sourced from PubChem (CID 58542665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).