About 7-[1-(2,3-difluoro-4-methylphenyl)-2-(4-methyl-2-pyridinyl)ethyl]-2-methylquinolin-8-ol
7-[1-(2,3-difluoro-4-methylphenyl)-2-(4-methyl-2-pyridinyl)ethyl]-2-methylquinolin-8-ol (PubChem CID 58542765) has the molecular formula C25H22F2N2O
and a molecular weight of 404.46 g/mol. Its IUPAC name is 7-[1-(2,3-difluoro-4-methylphenyl)-2-(4-methyl-2-pyridinyl)ethyl]-2-methylquinolin-8-ol.
Molecular Properties
| Compound Name | 7-[1-(2,3-difluoro-4-methylphenyl)-2-(4-methyl-2-pyridinyl)ethyl]-2-methylquinolin-8-ol |
| PubChem CID | 58542765 |
| Molecular Formula | C25H22F2N2O |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 7-[1-(2,3-difluoro-4-methylphenyl)-2-(4-methyl-2-pyridinyl)ethyl]-2-methylquinolin-8-ol |
| SMILES | Cc1ccnc(CC(c2ccc(C)c(F)c2F)c2ccc3ccc(C)nc3c2O)c1 |
| InChI | InChI=1S/C25H22F2N2O/c1-14-10-11-28-18(12-14)13-21(19-8-4-15(2)22(26)23(19)27)20-9-7-17-6-5-16(3)29-24(17)25(20)30/h4-12,21,30H,13H2,1-3H3 |
| InChIKey | HOBIDPJYTHWNDL-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-[1-(2,3-difluoro-4-methylphenyl)-2-(4-methyl-2-pyridinyl)ethyl]-2-methylquinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[1-(2,3-difluoro-4-methylphenyl)-2-(4-methyl-2-pyridinyl)ethyl]-2-methylquinolin-8-ol?
The IUPAC name of 7-[1-(2,3-difluoro-4-methylphenyl)-2-(4-methyl-2-pyridinyl)ethyl]-2-methylquinolin-8-ol (CID 58542765) is 7-[1-(2,3-difluoro-4-methylphenyl)-2-(4-methyl-2-pyridinyl)ethyl]-2-methylquinolin-8-ol.
What is the SMILES notation for 7-[1-(2,3-difluoro-4-methylphenyl)-2-(4-methyl-2-pyridinyl)ethyl]-2-methylquinolin-8-ol?
The canonical SMILES for 7-[1-(2,3-difluoro-4-methylphenyl)-2-(4-methyl-2-pyridinyl)ethyl]-2-methylquinolin-8-ol is Cc1ccnc(CC(c2ccc(C)c(F)c2F)c2ccc3ccc(C)nc3c2O)c1.
What is the InChIKey of 7-[1-(2,3-difluoro-4-methylphenyl)-2-(4-methyl-2-pyridinyl)ethyl]-2-methylquinolin-8-ol?
The InChIKey is HOBIDPJYTHWNDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22F2N2O/c1-14-10-11-28-18(12-14)13-21(19-8-4-15(2)22(26)23(19)27)20-9-7-17-6-5-16(3)29-24(17)25(20)30/h4-12,21,30H,13H2,1-3H3.
What are the key properties of 7-[1-(2,3-difluoro-4-methylphenyl)-2-(4-methyl-2-pyridinyl)ethyl]-2-methylquinolin-8-ol?
7-[1-(2,3-difluoro-4-methylphenyl)-2-(4-methyl-2-pyridinyl)ethyl]-2-methylquinolin-8-ol has a molecular weight of 404.46 g/mol, XLogP of 5.91, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[1-(2,3-difluoro-4-methylphenyl)-2-(4-methyl-2-pyridinyl)ethyl]-2-methylquinolin-8-ol is sourced from PubChem (CID 58542765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).