C25H17F7N2O2 — CID 58542831
7-[2-(4-methyl-2-pyridinyl)-1-[2,3,5,6-tetrafluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]quinolin-8-ol (PubChem CID 58542831) has the molecular formula C25H17F7N2O2 and a molecular weight of 510.41 g/mol. Its IUPAC name is 7-[2-(4-methyl-2-pyridinyl)-1-[2,3,5,6-tetrafluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]quinolin-8-ol.
| Compound Name | 7-[2-(4-methyl-2-pyridinyl)-1-[2,3,5,6-tetrafluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]quinolin-8-ol |
|---|---|
| PubChem CID | 58542831 |
| Molecular Formula | C25H17F7N2O2 |
| Molecular Weight | 510.41 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 7-[2-(4-methyl-2-pyridinyl)-1-[2,3,5,6-tetrafluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]quinolin-8-ol |
| SMILES | Cc1ccnc(CC(c2ccc3cccnc3c2O)c2c(F)c(F)c(OCC(F)(F)F)c(F)c2F)c1 |
| InChI | InChI=1S/C25H17F7N2O2/c1-12-6-8-33-14(9-12)10-16(15-5-4-13-3-2-7-34-22(13)23(15)35)17-18(26)20(28)24(21(29)19(17)27)36-11-25(30,31)32/h2-9,16,35H,10-11H2,1H3 |
| InChIKey | RWHOTVIKSVZAOE-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.41 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|