C22H14ClF4N3O — CID 58542888
7-[[(5-chloro-4-methyl-2-pyridinyl)amino]-(2,3,5,6-tetrafluorophenyl)methyl]quinolin-8-ol (PubChem CID 58542888) has the molecular formula C22H14ClF4N3O and a molecular weight of 447.82 g/mol. Its IUPAC name is 7-[[(5-chloro-4-methyl-2-pyridinyl)amino]-(2,3,5,6-tetrafluorophenyl)methyl]quinolin-8-ol.
| Compound Name | 7-[[(5-chloro-4-methyl-2-pyridinyl)amino]-(2,3,5,6-tetrafluorophenyl)methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 58542888 |
| Molecular Formula | C22H14ClF4N3O |
| Molecular Weight | 447.82 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 7-[[(5-chloro-4-methyl-2-pyridinyl)amino]-(2,3,5,6-tetrafluorophenyl)methyl]quinolin-8-ol |
| SMILES | Cc1cc(NC(c2ccc3cccnc3c2O)c2c(F)c(F)cc(F)c2F)ncc1Cl |
| InChI | InChI=1S/C22H14ClF4N3O/c1-10-7-16(29-9-13(10)23)30-21(17-18(26)14(24)8-15(25)19(17)27)12-5-4-11-3-2-6-28-20(11)22(12)31/h2-9,21,31H,1H3,(H,29,30) |
| InChIKey | DVYGPDCAQVCLOZ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.82 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|