About 7-[(2,4-dichlorophenyl)-[(5-fluoro-4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol
7-[(2,4-dichlorophenyl)-[(5-fluoro-4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol (PubChem CID 58543151) has the molecular formula C22H16Cl2FN3O
and a molecular weight of 428.29 g/mol. Its IUPAC name is 7-[(2,4-dichlorophenyl)-[(5-fluoro-4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol.
Molecular Properties
| Compound Name | 7-[(2,4-dichlorophenyl)-[(5-fluoro-4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol |
| PubChem CID | 58543151 |
| Molecular Formula | C22H16Cl2FN3O |
| Molecular Weight | 428.29 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 7-[(2,4-dichlorophenyl)-[(5-fluoro-4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol |
| SMILES | Cc1cc(NC(c2ccc(Cl)cc2Cl)c2ccc3cccnc3c2O)ncc1F |
| InChI | InChI=1S/C22H16Cl2FN3O/c1-12-9-19(27-11-18(12)25)28-21(15-7-5-14(23)10-17(15)24)16-6-4-13-3-2-8-26-20(13)22(16)29/h2-11,21,29H,1H3,(H,27,28) |
| InChIKey | YKQJGXZRADQOGM-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.29 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 7-[(2,4-dichlorophenyl)-[(5-fluoro-4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(2,4-dichlorophenyl)-[(5-fluoro-4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol?
The IUPAC name of 7-[(2,4-dichlorophenyl)-[(5-fluoro-4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol (CID 58543151) is 7-[(2,4-dichlorophenyl)-[(5-fluoro-4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol.
What is the SMILES notation for 7-[(2,4-dichlorophenyl)-[(5-fluoro-4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol?
The canonical SMILES for 7-[(2,4-dichlorophenyl)-[(5-fluoro-4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol is Cc1cc(NC(c2ccc(Cl)cc2Cl)c2ccc3cccnc3c2O)ncc1F.
What is the InChIKey of 7-[(2,4-dichlorophenyl)-[(5-fluoro-4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol?
The InChIKey is YKQJGXZRADQOGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16Cl2FN3O/c1-12-9-19(27-11-18(12)25)28-21(15-7-5-14(23)10-17(15)24)16-6-4-13-3-2-8-26-20(13)22(16)29/h2-11,21,29H,1H3,(H,27,28).
What are the key properties of 7-[(2,4-dichlorophenyl)-[(5-fluoro-4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol?
7-[(2,4-dichlorophenyl)-[(5-fluoro-4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol has a molecular weight of 428.29 g/mol, XLogP of 6.29, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(2,4-dichlorophenyl)-[(5-fluoro-4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol is sourced from PubChem (CID 58543151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).