C13H25NO4 — CID 58543416
N-[[(1R,2R,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]methyl]hexanamide (PubChem CID 58543416) has the molecular formula C13H25NO4 and a molecular weight of 259.35 g/mol. Its IUPAC name is N-[[(1R,2R,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]methyl]hexanamide.
| Compound Name | N-[[(1R,2R,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]methyl]hexanamide |
|---|---|
| PubChem CID | 58543416 |
| Molecular Formula | C13H25NO4 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | N-[[(1R,2R,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]methyl]hexanamide |
| SMILES | CCCCCC(=O)NC[C@H]1C[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H25NO4/c1-2-3-4-5-11(16)14-7-9-6-10(8-15)13(18)12(9)17/h9-10,12-13,15,17-18H,2-8H2,1H3,(H,14,16)/t9-,10-,12-,13-/m1/s1 |
| InChIKey | WYPHGEBIPRKPAU-FPQZTECRSA-N |
| XLogP | 0.03 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|