C11H12F3NO3 — CID 58543591
2-(2,3-dimethyl-5-nitrophenyl)-1,1,1-trifluoropropan-2-ol (PubChem CID 58543591) has the molecular formula C11H12F3NO3 and a molecular weight of 263.21 g/mol. Its IUPAC name is 2-(2,3-dimethyl-5-nitrophenyl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-(2,3-dimethyl-5-nitrophenyl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 58543591 |
| Molecular Formula | C11H12F3NO3 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 2-(2,3-dimethyl-5-nitrophenyl)-1,1,1-trifluoropropan-2-ol |
| SMILES | Cc1cc([N+](=O)[O-])cc(C(C)(O)C(F)(F)F)c1C |
| InChI | InChI=1S/C11H12F3NO3/c1-6-4-8(15(17)18)5-9(7(6)2)10(3,16)11(12,13)14/h4-5,16H,1-3H3 |
| InChIKey | AFSMFAHAUSWCFW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|