About 3-(hydroxymethyl)-2,6-dimethylbenzoic acid
3-(hydroxymethyl)-2,6-dimethylbenzoic acid (PubChem CID 58543757) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 3-(hydroxymethyl)-2,6-dimethylbenzoic acid.
Molecular Properties
| Compound Name | 3-(hydroxymethyl)-2,6-dimethylbenzoic acid |
| PubChem CID | 58543757 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 3-(hydroxymethyl)-2,6-dimethylbenzoic acid |
| SMILES | Cc1ccc(CO)c(C)c1C(=O)O |
| InChI | InChI=1S/C10H12O3/c1-6-3-4-8(5-11)7(2)9(6)10(12)13/h3-4,11H,5H2,1-2H3,(H,12,13) |
| InChIKey | BYTDKZFYIIPLLY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(hydroxymethyl)-2,6-dimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(hydroxymethyl)-2,6-dimethylbenzoic acid?
The IUPAC name of 3-(hydroxymethyl)-2,6-dimethylbenzoic acid (CID 58543757) is 3-(hydroxymethyl)-2,6-dimethylbenzoic acid.
What is the SMILES notation for 3-(hydroxymethyl)-2,6-dimethylbenzoic acid?
The canonical SMILES for 3-(hydroxymethyl)-2,6-dimethylbenzoic acid is Cc1ccc(CO)c(C)c1C(=O)O.
What is the InChIKey of 3-(hydroxymethyl)-2,6-dimethylbenzoic acid?
The InChIKey is BYTDKZFYIIPLLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-6-3-4-8(5-11)7(2)9(6)10(12)13/h3-4,11H,5H2,1-2H3,(H,12,13).
What are the key properties of 3-(hydroxymethyl)-2,6-dimethylbenzoic acid?
3-(hydroxymethyl)-2,6-dimethylbenzoic acid has a molecular weight of 180.20 g/mol, XLogP of 1.49, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(hydroxymethyl)-2,6-dimethylbenzoic acid is sourced from PubChem (CID 58543757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).